C22H17BrN2O4 — CID 40789411
(5S)-3-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione (PubChem CID 40789411) has the molecular formula C22H17BrN2O4 and a molecular weight of 453.29 g/mol. Its IUPAC name is (5S)-3-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40789411 |
| Molecular Formula | C22H17BrN2O4 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (5S)-3-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2cccc3ccccc23)NC(=O)N(Cc2cc3c(cc2Br)OCO3)C1=O |
| InChI | InChI=1S/C22H17BrN2O4/c1-22(16-8-4-6-13-5-2-3-7-15(13)16)20(26)25(21(27)24-22)11-14-9-18-19(10-17(14)23)29-12-28-18/h2-10H,11-12H2,1H3,(H,24,27)/t22-/m0/s1 |
| InChIKey | OXNXCOIMAPTMJM-QFIPXVFZSA-N |
| XLogP | 4.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|