C18H14Br2N2O4 — CID 41190166
(5R)-3-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-5-(3-bromophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 41190166) has the molecular formula C18H14Br2N2O4 and a molecular weight of 482.13 g/mol. Its IUPAC name is (5R)-3-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-5-(3-bromophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-5-(3-bromophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41190166 |
| Molecular Formula | C18H14Br2N2O4 |
| Molecular Weight | 482.13 g/mol |
| Exact Mass | 479.93 |
| IUPAC Name | (5R)-3-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-5-(3-bromophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cccc(Br)c2)NC(=O)N(Cc2cc3c(cc2Br)OCO3)C1=O |
| InChI | InChI=1S/C18H14Br2N2O4/c1-18(11-3-2-4-12(19)6-11)16(23)22(17(24)21-18)8-10-5-14-15(7-13(10)20)26-9-25-14/h2-7H,8-9H2,1H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | RWEIUXCOEJHKGT-GOSISDBHSA-N |
| XLogP | 3.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.13 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|