C16H16BrN3O3 — CID 52514080
(5S)-5-(3-bromophenyl)-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 52514080) has the molecular formula C16H16BrN3O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is (5S)-5-(3-bromophenyl)-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(3-bromophenyl)-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52514080 |
| Molecular Formula | C16H16BrN3O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (5S)-5-(3-bromophenyl)-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1nc(CN2C(=O)N[C@@](C)(c3cccc(Br)c3)C2=O)oc1C |
| InChI | InChI=1S/C16H16BrN3O3/c1-9-10(2)23-13(18-9)8-20-14(21)16(3,19-15(20)22)11-5-4-6-12(17)7-11/h4-7H,8H2,1-3H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | FAEAPURPAQDEGJ-INIZCTEOSA-N |
| XLogP | 3.02 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|