C23H24N3O2S+ — CID 11925352
(5S)-5-methyl-5-naphthalen-1-yl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 11925352) has the molecular formula C23H24N3O2S+ and a molecular weight of 406.53 g/mol. Its IUPAC name is (5S)-5-methyl-5-naphthalen-1-yl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-naphthalen-1-yl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11925352 |
| Molecular Formula | C23H24N3O2S+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (5S)-5-methyl-5-naphthalen-1-yl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2cccc3ccccc23)NC(=O)N(C[NH+]2CCC[C@@H]2c2cccs2)C1=O |
| InChI | InChI=1S/C23H23N3O2S/c1-23(18-10-4-8-16-7-2-3-9-17(16)18)21(27)26(22(28)24-23)15-25-13-5-11-19(25)20-12-6-14-29-20/h2-4,6-10,12,14,19H,5,11,13,15H2,1H3,(H,24,28)/p+1/t19-,23+/m1/s1 |
| InChIKey | DYMXVEUMUPVQSA-XXBNENTESA-O |
| XLogP | 3.05 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|