C17H16N2O3S — CID 71924992
2-[(2-phenyl-1,3-oxazol-4-yl)methyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 71924992) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-[(2-phenyl-1,3-oxazol-4-yl)methyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[(2-phenyl-1,3-oxazol-4-yl)methyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 71924992 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-[(2-phenyl-1,3-oxazol-4-yl)methyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1CC2(CCSC2)C(=O)N1Cc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H16N2O3S/c20-14-8-17(6-7-23-11-17)16(21)19(14)9-13-10-22-15(18-13)12-4-2-1-3-5-12/h1-5,10H,6-9,11H2 |
| InChIKey | DUAGUPLHGWRWCI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|