About 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one
7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one (PubChem CID 71880430) has the molecular formula C21H21N3O2
and a molecular weight of 347.42 g/mol. Its IUPAC name is 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one |
| PubChem CID | 71880430 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one |
| SMILES | O=C1CC(c2ccccc2)N(Cc2coc(-c3ccccc3)n2)CCN1 |
| InChI | InChI=1S/C21H21N3O2/c25-20-13-19(16-7-3-1-4-8-16)24(12-11-22-20)14-18-15-26-21(23-18)17-9-5-2-6-10-17/h1-10,15,19H,11-14H2,(H,22,25) |
| InChIKey | KSCDJDVRCJKODT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one?
The IUPAC name of 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one (CID 71880430) is 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one.
What is the SMILES notation for 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one?
The canonical SMILES for 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one is O=C1CC(c2ccccc2)N(Cc2coc(-c3ccccc3)n2)CCN1.
What is the InChIKey of 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one?
The InChIKey is KSCDJDVRCJKODT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O2/c25-20-13-19(16-7-3-1-4-8-16)24(12-11-22-20)14-18-15-26-21(23-18)17-9-5-2-6-10-17/h1-10,15,19H,11-14H2,(H,22,25).
What are the key properties of 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one?
7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one has a molecular weight of 347.42 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one is sourced from PubChem (CID 71880430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).