C21H21N3O2 — CID 71880430
7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one (PubChem CID 71880430) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one.
| Compound Name | 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 71880430 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 7-phenyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-1,4-diazepan-5-one |
| SMILES | O=C1CC(c2ccccc2)N(Cc2coc(-c3ccccc3)n2)CCN1 |
| InChI | InChI=1S/C21H21N3O2/c25-20-13-19(16-7-3-1-4-8-16)24(12-11-22-20)14-18-15-26-21(23-18)17-9-5-2-6-10-17/h1-10,15,19H,11-14H2,(H,22,25) |
| InChIKey | KSCDJDVRCJKODT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |