C20H21N5O — CID 139002085
7-phenyl-1-[(3-phenyltriazol-4-yl)methyl]-1,4-diazepan-5-one (PubChem CID 139002085) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 7-phenyl-1-[(3-phenyltriazol-4-yl)methyl]-1,4-diazepan-5-one.
| Compound Name | 7-phenyl-1-[(3-phenyltriazol-4-yl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 139002085 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 7-phenyl-1-[(3-phenyltriazol-4-yl)methyl]-1,4-diazepan-5-one |
| SMILES | O=C1CC(c2ccccc2)N(Cc2cnnn2-c2ccccc2)CCN1 |
| InChI | InChI=1S/C20H21N5O/c26-20-13-19(16-7-3-1-4-8-16)24(12-11-21-20)15-18-14-22-23-25(18)17-9-5-2-6-10-17/h1-10,14,19H,11-13,15H2,(H,21,26) |
| InChIKey | JGGPCIRSTZSSMU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |