C17H25N3O — CID 119930634
7-phenyl-1-(piperidin-4-ylmethyl)-1,4-diazepan-5-one (PubChem CID 119930634) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 7-phenyl-1-(piperidin-4-ylmethyl)-1,4-diazepan-5-one.
| Compound Name | 7-phenyl-1-(piperidin-4-ylmethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 119930634 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 7-phenyl-1-(piperidin-4-ylmethyl)-1,4-diazepan-5-one |
| SMILES | O=C1CC(c2ccccc2)N(CC2CCNCC2)CCN1 |
| InChI | InChI=1S/C17H25N3O/c21-17-12-16(15-4-2-1-3-5-15)20(11-10-19-17)13-14-6-8-18-9-7-14/h1-5,14,16,18H,6-13H2,(H,19,21) |
| InChIKey | NBJRWEDGZCTTLX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |