C15H20N2O3 — CID 97062578
methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate (PubChem CID 97062578) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate.
| Compound Name | methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate |
|---|---|
| PubChem CID | 97062578 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate |
| SMILES | COC(=O)CCN1CCNC(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c1-20-15(19)7-9-17-10-8-16-14(18)11-13(17)12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | NZLDYWYAGNAYSY-CYBMUJFWSA-N |
| XLogP | 1.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |