methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate

C15H20N2O3 — CID 97062578

IUPACmethyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate
SMILESCOC(=O)CCN1CCNC(=O)C[C@@H]1c1ccccc1
InChIInChI=1S/C15H20N2O3/c1-20-15(19)7-9-17-10-8-16-14(18)11-13(17)12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,16,18)/t13-/m1/s1
InChIKeyNZLDYWYAGNAYSY-CYBMUJFWSA-N
MW276.34 g/mol
LogP1.11
Rot. Bonds4

About methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate

methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate (PubChem CID 97062578) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate.

Molecular Properties

Compound Namemethyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate
PubChem CID97062578
Molecular FormulaC15H20N2O3
Molecular Weight276.34 g/mol
Exact Mass276.15
IUPAC Namemethyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate
SMILESCOC(=O)CCN1CCNC(=O)C[C@@H]1c1ccccc1
InChIInChI=1S/C15H20N2O3/c1-20-15(19)7-9-17-10-8-16-14(18)11-13(17)12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,16,18)/t13-/m1/s1
InChIKeyNZLDYWYAGNAYSY-CYBMUJFWSA-N
XLogP1.11
TPSA58.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.34
LogP ≤ 51.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate?
The IUPAC name of methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate (CID 97062578) is methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate.
What is the SMILES notation for methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate?
The canonical SMILES for methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate is COC(=O)CCN1CCNC(=O)C[C@@H]1c1ccccc1.
What is the InChIKey of methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate?
The InChIKey is NZLDYWYAGNAYSY-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-20-15(19)7-9-17-10-8-16-14(18)11-13(17)12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,16,18)/t13-/m1/s1.
What are the key properties of methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate?
methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate has a molecular weight of 276.34 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(7R)-5-oxo-7-phenyl-1,4-diazepan-1-yl]propanoate is sourced from PubChem (CID 97062578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).