C18H24N4O — CID 124884053
(7R)-1-[2-(2-ethylpyrazol-3-yl)ethyl]-7-phenyl-1,4-diazepan-5-one (PubChem CID 124884053) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is (7R)-1-[2-(2-ethylpyrazol-3-yl)ethyl]-7-phenyl-1,4-diazepan-5-one.
| Compound Name | (7R)-1-[2-(2-ethylpyrazol-3-yl)ethyl]-7-phenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 124884053 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (7R)-1-[2-(2-ethylpyrazol-3-yl)ethyl]-7-phenyl-1,4-diazepan-5-one |
| SMILES | CCn1nccc1CCN1CCNC(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H24N4O/c1-2-22-16(8-10-20-22)9-12-21-13-11-19-18(23)14-17(21)15-6-4-3-5-7-15/h3-8,10,17H,2,9,11-14H2,1H3,(H,19,23)/t17-/m1/s1 |
| InChIKey | VDVACIKXBFPQTH-QGZVFWFLSA-N |
| XLogP | 2.01 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |