C13H18N2O — CID 86192713
1-methyl-8-phenyl-1,4-diazocan-5-one (PubChem CID 86192713) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-methyl-8-phenyl-1,4-diazocan-5-one.
| Compound Name | 1-methyl-8-phenyl-1,4-diazocan-5-one |
|---|---|
| PubChem CID | 86192713 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-methyl-8-phenyl-1,4-diazocan-5-one |
| SMILES | CN1CCNC(=O)CCC1c1ccccc1 |
| InChI | InChI=1S/C13H18N2O/c1-15-10-9-14-13(16)8-7-12(15)11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3,(H,14,16) |
| InChIKey | PMNGGSYYOGTJHS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |