About 4-phenylazetidin-2-one;pyrrolidin-2-one
4-phenylazetidin-2-one;pyrrolidin-2-one (PubChem CID 67067150) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-phenylazetidin-2-one;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-phenylazetidin-2-one;pyrrolidin-2-one |
| PubChem CID | 67067150 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4-phenylazetidin-2-one;pyrrolidin-2-one |
| SMILES | O=C1CC(c2ccccc2)N1.O=C1CCCN1 |
| InChI | InChI=1S/C9H9NO.C4H7NO/c11-9-6-8(10-9)7-4-2-1-3-5-7;6-4-2-1-3-5-4/h1-5,8H,6H2,(H,10,11);1-3H2,(H,5,6) |
| InChIKey | WUAGVPXMAKAVLM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenylazetidin-2-one;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylazetidin-2-one;pyrrolidin-2-one?
The IUPAC name of 4-phenylazetidin-2-one;pyrrolidin-2-one (CID 67067150) is 4-phenylazetidin-2-one;pyrrolidin-2-one.
What is the SMILES notation for 4-phenylazetidin-2-one;pyrrolidin-2-one?
The canonical SMILES for 4-phenylazetidin-2-one;pyrrolidin-2-one is O=C1CC(c2ccccc2)N1.O=C1CCCN1.
What is the InChIKey of 4-phenylazetidin-2-one;pyrrolidin-2-one?
The InChIKey is WUAGVPXMAKAVLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO.C4H7NO/c11-9-6-8(10-9)7-4-2-1-3-5-7;6-4-2-1-3-5-4/h1-5,8H,6H2,(H,10,11);1-3H2,(H,5,6).
What are the key properties of 4-phenylazetidin-2-one;pyrrolidin-2-one?
4-phenylazetidin-2-one;pyrrolidin-2-one has a molecular weight of 232.28 g/mol, XLogP of 1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylazetidin-2-one;pyrrolidin-2-one is sourced from PubChem (CID 67067150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).