C14H20N2O — CID 101358017
4-phenyl-1,5-diazecan-2-one (PubChem CID 101358017) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-phenyl-1,5-diazecan-2-one.
| Compound Name | 4-phenyl-1,5-diazecan-2-one |
|---|---|
| PubChem CID | 101358017 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-phenyl-1,5-diazecan-2-one |
| SMILES | O=C1CC(c2ccccc2)NCCCCCN1 |
| InChI | InChI=1S/C14H20N2O/c17-14-11-13(12-7-3-1-4-8-12)15-9-5-2-6-10-16-14/h1,3-4,7-8,13,15H,2,5-6,9-11H2,(H,16,17) |
| InChIKey | FIXAPWNRQSTEKQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |