C27H32N4O3 — CID 163311645
1-methyl-3-(6-oxo-8-phenyl-1,5,9-triazacyclotridecane-1-carbonyl)quinolin-2-one (PubChem CID 163311645) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-methyl-3-(6-oxo-8-phenyl-1,5,9-triazacyclotridecane-1-carbonyl)quinolin-2-one.
| Compound Name | 1-methyl-3-(6-oxo-8-phenyl-1,5,9-triazacyclotridecane-1-carbonyl)quinolin-2-one |
|---|---|
| PubChem CID | 163311645 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 1-methyl-3-(6-oxo-8-phenyl-1,5,9-triazacyclotridecane-1-carbonyl)quinolin-2-one |
| SMILES | Cn1c(=O)c(C(=O)N2CCCCNC(c3ccccc3)CC(=O)NCCC2)cc2ccccc21 |
| InChI | InChI=1S/C27H32N4O3/c1-30-24-13-6-5-12-21(24)18-22(26(30)33)27(34)31-16-8-7-14-28-23(20-10-3-2-4-11-20)19-25(32)29-15-9-17-31/h2-6,10-13,18,23,28H,7-9,14-17,19H2,1H3,(H,29,32) |
| InChIKey | OCRMWWHEIZVHJA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |