About benzene-1,2-diamine;pyrrolidin-2-one
benzene-1,2-diamine;pyrrolidin-2-one (PubChem CID 163869140) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is benzene-1,2-diamine;pyrrolidin-2-one.
Molecular Properties
| Compound Name | benzene-1,2-diamine;pyrrolidin-2-one |
| PubChem CID | 163869140 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | benzene-1,2-diamine;pyrrolidin-2-one |
| SMILES | Nc1ccccc1N.O=C1CCCN1 |
| InChI | InChI=1S/C6H8N2.C4H7NO/c7-5-3-1-2-4-6(5)8;6-4-2-1-3-5-4/h1-4H,7-8H2;1-3H2,(H,5,6) |
| InChIKey | PJGDQVUEQFQTAS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diamine;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diamine;pyrrolidin-2-one?
The IUPAC name of benzene-1,2-diamine;pyrrolidin-2-one (CID 163869140) is benzene-1,2-diamine;pyrrolidin-2-one.
What is the SMILES notation for benzene-1,2-diamine;pyrrolidin-2-one?
The canonical SMILES for benzene-1,2-diamine;pyrrolidin-2-one is Nc1ccccc1N.O=C1CCCN1.
What is the InChIKey of benzene-1,2-diamine;pyrrolidin-2-one?
The InChIKey is PJGDQVUEQFQTAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C4H7NO/c7-5-3-1-2-4-6(5)8;6-4-2-1-3-5-4/h1-4H,7-8H2;1-3H2,(H,5,6).
What are the key properties of benzene-1,2-diamine;pyrrolidin-2-one?
benzene-1,2-diamine;pyrrolidin-2-one has a molecular weight of 193.25 g/mol, XLogP of 0.75, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diamine;pyrrolidin-2-one is sourced from PubChem (CID 163869140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).