About 2-butylaniline;pyrrolidin-2-one
2-butylaniline;pyrrolidin-2-one (PubChem CID 175394596) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-butylaniline;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-butylaniline;pyrrolidin-2-one |
| PubChem CID | 175394596 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-butylaniline;pyrrolidin-2-one |
| SMILES | CCCCc1ccccc1N.O=C1CCCN1 |
| InChI | InChI=1S/C10H15N.C4H7NO/c1-2-3-6-9-7-4-5-8-10(9)11;6-4-2-1-3-5-4/h4-5,7-8H,2-3,6,11H2,1H3;1-3H2,(H,5,6) |
| InChIKey | KRBXXMRCCJKQEB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-butylaniline;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylaniline;pyrrolidin-2-one?
The IUPAC name of 2-butylaniline;pyrrolidin-2-one (CID 175394596) is 2-butylaniline;pyrrolidin-2-one.
What is the SMILES notation for 2-butylaniline;pyrrolidin-2-one?
The canonical SMILES for 2-butylaniline;pyrrolidin-2-one is CCCCc1ccccc1N.O=C1CCCN1.
What is the InChIKey of 2-butylaniline;pyrrolidin-2-one?
The InChIKey is KRBXXMRCCJKQEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C4H7NO/c1-2-3-6-9-7-4-5-8-10(9)11;6-4-2-1-3-5-4/h4-5,7-8H,2-3,6,11H2,1H3;1-3H2,(H,5,6).
What are the key properties of 2-butylaniline;pyrrolidin-2-one?
2-butylaniline;pyrrolidin-2-one has a molecular weight of 234.34 g/mol, XLogP of 2.51, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylaniline;pyrrolidin-2-one is sourced from PubChem (CID 175394596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).