C17H18N2O — CID 71351344
(2S,7S)-2,7-diphenyl-1,4-diazepan-5-one (PubChem CID 71351344) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S,7S)-2,7-diphenyl-1,4-diazepan-5-one.
| Compound Name | (2S,7S)-2,7-diphenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 71351344 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2S,7S)-2,7-diphenyl-1,4-diazepan-5-one |
| SMILES | O=C1C[C@@H](c2ccccc2)N[C@@H](c2ccccc2)CN1 |
| InChI | InChI=1S/C17H18N2O/c20-17-11-15(13-7-3-1-4-8-13)19-16(12-18-17)14-9-5-2-6-10-14/h1-10,15-16,19H,11-12H2,(H,18,20)/t15-,16+/m0/s1 |
| InChIKey | HXCFNDCBTPQSCI-JKSUJKDBSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |