C20H24N4O — CID 78248250
6-phenyl-2-(4-phenylpiperazin-1-yl)-1,3-diazinan-4-one (PubChem CID 78248250) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 6-phenyl-2-(4-phenylpiperazin-1-yl)-1,3-diazinan-4-one.
| Compound Name | 6-phenyl-2-(4-phenylpiperazin-1-yl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 78248250 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 6-phenyl-2-(4-phenylpiperazin-1-yl)-1,3-diazinan-4-one |
| SMILES | O=C1CC(c2ccccc2)NC(N2CCN(c3ccccc3)CC2)N1 |
| InChI | InChI=1S/C20H24N4O/c25-19-15-18(16-7-3-1-4-8-16)21-20(22-19)24-13-11-23(12-14-24)17-9-5-2-6-10-17/h1-10,18,20-21H,11-15H2,(H,22,25) |
| InChIKey | STBMBKDADQYIMN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |