C22H28N4O2 — CID 73369312
2-[4-(3-methoxyphenyl)piperazin-1-yl]-6-(4-methylphenyl)-1,3-diazinan-4-one (PubChem CID 73369312) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[4-(3-methoxyphenyl)piperazin-1-yl]-6-(4-methylphenyl)-1,3-diazinan-4-one.
| Compound Name | 2-[4-(3-methoxyphenyl)piperazin-1-yl]-6-(4-methylphenyl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 73369312 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-[4-(3-methoxyphenyl)piperazin-1-yl]-6-(4-methylphenyl)-1,3-diazinan-4-one |
| SMILES | COc1cccc(N2CCN(C3NC(=O)CC(c4ccc(C)cc4)N3)CC2)c1 |
| InChI | InChI=1S/C22H28N4O2/c1-16-6-8-17(9-7-16)20-15-21(27)24-22(23-20)26-12-10-25(11-13-26)18-4-3-5-19(14-18)28-2/h3-9,14,20,22-23H,10-13,15H2,1-2H3,(H,24,27) |
| InChIKey | ZEPQZJUHGHFJCN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |