C20H23ClN4O — CID 73369799
6-(2-chlorophenyl)-2-(4-phenylpiperazin-1-yl)-1,3-diazinan-4-one (PubChem CID 73369799) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-2-(4-phenylpiperazin-1-yl)-1,3-diazinan-4-one.
| Compound Name | 6-(2-chlorophenyl)-2-(4-phenylpiperazin-1-yl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 73369799 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 6-(2-chlorophenyl)-2-(4-phenylpiperazin-1-yl)-1,3-diazinan-4-one |
| SMILES | O=C1CC(c2ccccc2Cl)NC(N2CCN(c3ccccc3)CC2)N1 |
| InChI | InChI=1S/C20H23ClN4O/c21-17-9-5-4-8-16(17)18-14-19(26)23-20(22-18)25-12-10-24(11-13-25)15-6-2-1-3-7-15/h1-9,18,20,22H,10-14H2,(H,23,26) |
| InChIKey | IBZYDNLZVSAUNE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |