C23H23ClN4O — CID 135546625
8-chloro-2-[3-(4-phenylpiperazin-1-yl)cyclopenten-1-yl]-3H-quinazolin-4-one (PubChem CID 135546625) has the molecular formula C23H23ClN4O and a molecular weight of 406.92 g/mol. Its IUPAC name is 8-chloro-2-[3-(4-phenylpiperazin-1-yl)cyclopenten-1-yl]-3H-quinazolin-4-one.
| Compound Name | 8-chloro-2-[3-(4-phenylpiperazin-1-yl)cyclopenten-1-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135546625 |
| Molecular Formula | C23H23ClN4O |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 8-chloro-2-[3-(4-phenylpiperazin-1-yl)cyclopenten-1-yl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(C2=CC(N3CCN(c4ccccc4)CC3)CC2)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C23H23ClN4O/c24-20-8-4-7-19-21(20)25-22(26-23(19)29)16-9-10-18(15-16)28-13-11-27(12-14-28)17-5-2-1-3-6-17/h1-8,15,18H,9-14H2,(H,25,26,29) |
| InChIKey | WNEPTDHWAVZIFO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |