C27H29FN4O — CID 73369311
2-(4-benzhydrylpiperazin-1-yl)-6-(4-fluorophenyl)-1,3-diazinan-4-one (PubChem CID 73369311) has the molecular formula C27H29FN4O and a molecular weight of 444.55 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-6-(4-fluorophenyl)-1,3-diazinan-4-one.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-6-(4-fluorophenyl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 73369311 |
| Molecular Formula | C27H29FN4O |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-6-(4-fluorophenyl)-1,3-diazinan-4-one |
| SMILES | O=C1CC(c2ccc(F)cc2)NC(N2CCN(C(c3ccccc3)c3ccccc3)CC2)N1 |
| InChI | InChI=1S/C27H29FN4O/c28-23-13-11-20(12-14-23)24-19-25(33)30-27(29-24)32-17-15-31(16-18-32)26(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14,24,26-27,29H,15-19H2,(H,30,33) |
| InChIKey | ZXGVLDFVPPQHJE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |