C24H32N4O — CID 78411599
2-(4-benzhydrylpiperazin-1-yl)-6-propan-2-yl-1,3-diazinan-4-one (PubChem CID 78411599) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-6-propan-2-yl-1,3-diazinan-4-one.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-6-propan-2-yl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 78411599 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-6-propan-2-yl-1,3-diazinan-4-one |
| SMILES | CC(C)C1CC(=O)NC(N2CCN(C(c3ccccc3)c3ccccc3)CC2)N1 |
| InChI | InChI=1S/C24H32N4O/c1-18(2)21-17-22(29)26-24(25-21)28-15-13-27(14-16-28)23(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,18,21,23-25H,13-17H2,1-2H3,(H,26,29) |
| InChIKey | XMQRIFFVLHJMCC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |