C17H17N3O2 — CID 22769787
5-benzhydryl-1,2,5-triazepane-3,7-dione (PubChem CID 22769787) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 5-benzhydryl-1,2,5-triazepane-3,7-dione.
| Compound Name | 5-benzhydryl-1,2,5-triazepane-3,7-dione |
|---|---|
| PubChem CID | 22769787 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-benzhydryl-1,2,5-triazepane-3,7-dione |
| SMILES | O=C1CN(C(c2ccccc2)c2ccccc2)CC(=O)NN1 |
| InChI | InChI=1S/C17H17N3O2/c21-15-11-20(12-16(22)19-18-15)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,17H,11-12H2,(H,18,21)(H,19,22) |
| InChIKey | JFLMHANCGZRKDG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |