C20H21N5O — CID 135763966
3-(4-benzhydrylpiperazin-1-yl)-4H-1,2,4-triazin-5-one (PubChem CID 135763966) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-(4-benzhydrylpiperazin-1-yl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(4-benzhydrylpiperazin-1-yl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135763966 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-(4-benzhydrylpiperazin-1-yl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(N2CCN(C(c3ccccc3)c3ccccc3)CC2)[nH]1 |
| InChI | InChI=1S/C20H21N5O/c26-18-15-21-23-20(22-18)25-13-11-24(12-14-25)19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,15,19H,11-14H2,(H,22,23,26) |
| InChIKey | YISKATTYNZZONH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |