C30H32N4O — CID 135644719
2-(4-benzhydrylpiperazin-1-yl)-4-methyl-5-[(4-methylphenyl)methyl]-1H-pyrimidin-6-one (PubChem CID 135644719) has the molecular formula C30H32N4O and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-4-methyl-5-[(4-methylphenyl)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-4-methyl-5-[(4-methylphenyl)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135644719 |
| Molecular Formula | C30H32N4O |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-4-methyl-5-[(4-methylphenyl)methyl]-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Cc2c(C)nc(N3CCN(C(c4ccccc4)c4ccccc4)CC3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C30H32N4O/c1-22-13-15-24(16-14-22)21-27-23(2)31-30(32-29(27)35)34-19-17-33(18-20-34)28(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3-16,28H,17-21H2,1-2H3,(H,31,32,35) |
| InChIKey | XCKQQSPCTKJPIE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |