C26H30N4O2 — CID 135893912
2-(4-benzhydrylpiperazin-1-yl)-4-(methoxymethyl)-5-prop-2-enyl-1H-pyrimidin-6-one (PubChem CID 135893912) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-4-(methoxymethyl)-5-prop-2-enyl-1H-pyrimidin-6-one.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-4-(methoxymethyl)-5-prop-2-enyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135893912 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-4-(methoxymethyl)-5-prop-2-enyl-1H-pyrimidin-6-one |
| SMILES | C=CCc1c(COC)nc(N2CCN(C(c3ccccc3)c3ccccc3)CC2)[nH]c1=O |
| InChI | InChI=1S/C26H30N4O2/c1-3-10-22-23(19-32-2)27-26(28-25(22)31)30-17-15-29(16-18-30)24(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h3-9,11-14,24H,1,10,15-19H2,2H3,(H,27,28,31) |
| InChIKey | WHLOHAXOKGFKRB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|