C22H25FN2O — CID 97014859
N-cyclopropyl-1-[(R)-(4-fluorophenyl)-phenylmethyl]piperidine-4-carboxamide (PubChem CID 97014859) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is N-cyclopropyl-1-[(R)-(4-fluorophenyl)-phenylmethyl]piperidine-4-carboxamide.
| Compound Name | N-cyclopropyl-1-[(R)-(4-fluorophenyl)-phenylmethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 97014859 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-cyclopropyl-1-[(R)-(4-fluorophenyl)-phenylmethyl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CC1)C1CCN([C@H](c2ccccc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H25FN2O/c23-19-8-6-17(7-9-19)21(16-4-2-1-3-5-16)25-14-12-18(13-15-25)22(26)24-20-10-11-20/h1-9,18,20-21H,10-15H2,(H,24,26)/t21-/m1/s1 |
| InChIKey | VXRYCAOXCGDDNR-OAQYLSRUSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |