C23H25FN2O2 — CID 134035144
1-(cyclopropanecarbonyl)-N-[(4-fluorophenyl)-phenylmethyl]piperidine-4-carboxamide (PubChem CID 134035144) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-N-[(4-fluorophenyl)-phenylmethyl]piperidine-4-carboxamide.
| Compound Name | 1-(cyclopropanecarbonyl)-N-[(4-fluorophenyl)-phenylmethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134035144 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-N-[(4-fluorophenyl)-phenylmethyl]piperidine-4-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccc(F)cc1)C1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C23H25FN2O2/c24-20-10-8-17(9-11-20)21(16-4-2-1-3-5-16)25-22(27)18-12-14-26(15-13-18)23(28)19-6-7-19/h1-5,8-11,18-19,21H,6-7,12-15H2,(H,25,27) |
| InChIKey | OGCGJPJQZRVVGW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |