C26H27FN4O2 — CID 126475651
1-N-benzyl-4-N-[(4-fluorophenyl)-pyridin-2-ylmethyl]piperidine-1,4-dicarboxamide (PubChem CID 126475651) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is 1-N-benzyl-4-N-[(4-fluorophenyl)-pyridin-2-ylmethyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-benzyl-4-N-[(4-fluorophenyl)-pyridin-2-ylmethyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 126475651 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 1-N-benzyl-4-N-[(4-fluorophenyl)-pyridin-2-ylmethyl]piperidine-1,4-dicarboxamide |
| SMILES | O=C(NC(c1ccc(F)cc1)c1ccccn1)C1CCN(C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H27FN4O2/c27-22-11-9-20(10-12-22)24(23-8-4-5-15-28-23)30-25(32)21-13-16-31(17-14-21)26(33)29-18-19-6-2-1-3-7-19/h1-12,15,21,24H,13-14,16-18H2,(H,29,33)(H,30,32) |
| InChIKey | FQFGYAUAFUSMFR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |