C27H34FN3O2 — CID 121427398
N-[(4-fluorophenyl)-pyridin-2-ylmethyl]-1-[2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]oxypropan-2-yl]piperidine-4-carboxamide (PubChem CID 121427398) has the molecular formula C27H34FN3O2 and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-pyridin-2-ylmethyl]-1-[2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]oxypropan-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)-pyridin-2-ylmethyl]-1-[2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]oxypropan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121427398 |
| Molecular Formula | C27H34FN3O2 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-[(4-fluorophenyl)-pyridin-2-ylmethyl]-1-[2-methyl-1-[(3Z)-penta-1,3-dien-2-yl]oxypropan-2-yl]piperidine-4-carboxamide |
| SMILES | C=C(/C=C\C)OCC(C)(C)N1CCC(C(=O)NC(c2ccc(F)cc2)c2ccccn2)CC1 |
| InChI | InChI=1S/C27H34FN3O2/c1-5-8-20(2)33-19-27(3,4)31-17-14-22(15-18-31)26(32)30-25(24-9-6-7-16-29-24)21-10-12-23(28)13-11-21/h5-13,16,22,25H,2,14-15,17-19H2,1,3-4H3,(H,30,32)/b8-5- |
| InChIKey | QNXSMHRZXWRCPS-YVMONPNESA-N |
| XLogP | 5.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|