C23H29N3O5 — CID 126475457
2-methoxyethyl 4-[[(4-methoxyphenyl)-pyridin-2-ylmethyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 126475457) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[(4-methoxyphenyl)-pyridin-2-ylmethyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | 2-methoxyethyl 4-[[(4-methoxyphenyl)-pyridin-2-ylmethyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126475457 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-methoxyethyl 4-[[(4-methoxyphenyl)-pyridin-2-ylmethyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | COCCOC(=O)N1CCC(C(=O)NC(c2ccc(OC)cc2)c2ccccn2)CC1 |
| InChI | InChI=1S/C23H29N3O5/c1-29-15-16-31-23(28)26-13-10-18(11-14-26)22(27)25-21(20-5-3-4-12-24-20)17-6-8-19(30-2)9-7-17/h3-9,12,18,21H,10-11,13-16H2,1-2H3,(H,25,27) |
| InChIKey | GSISASFGIRLQDW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|