C21H21F2NO3 — CID 120674116
4-[bis(4-fluorophenyl)methylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120674116) has the molecular formula C21H21F2NO3 and a molecular weight of 373.40 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)methylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[bis(4-fluorophenyl)methylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120674116 |
| Molecular Formula | C21H21F2NO3 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-[bis(4-fluorophenyl)methylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H21F2NO3/c22-17-9-5-13(6-10-17)19(14-7-11-18(23)12-8-14)24-20(25)15-1-3-16(4-2-15)21(26)27/h5-12,15-16,19H,1-4H2,(H,24,25)(H,26,27) |
| InChIKey | YUEKGRXRDRENQB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |