C13H14FNO3 — CID 130277314
methyl 2-(cyclopropanecarbonylamino)-2-(4-fluorophenyl)acetate (PubChem CID 130277314) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is methyl 2-(cyclopropanecarbonylamino)-2-(4-fluorophenyl)acetate.
| Compound Name | methyl 2-(cyclopropanecarbonylamino)-2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 130277314 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | methyl 2-(cyclopropanecarbonylamino)-2-(4-fluorophenyl)acetate |
| SMILES | COC(=O)C(NC(=O)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H14FNO3/c1-18-13(17)11(15-12(16)9-2-3-9)8-4-6-10(14)7-5-8/h4-7,9,11H,2-3H2,1H3,(H,15,16) |
| InChIKey | RFLLFPRDIPNLSV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |