About methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate
methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate (PubChem CID 95284034) has the molecular formula C15H17F2NO3
and a molecular weight of 297.30 g/mol. Its IUPAC name is methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate.
Molecular Properties
| Compound Name | methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate |
| PubChem CID | 95284034 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate |
| SMILES | COC(=O)[C@@H](NC(=O)C1CCCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H17F2NO3/c1-21-15(20)13(11-8-10(16)6-7-12(11)17)18-14(19)9-4-2-3-5-9/h6-9,13H,2-5H2,1H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | VELWNNYKANLOCN-ZDUSSCGKSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate?
The IUPAC name of methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate (CID 95284034) is methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate.
What is the SMILES notation for methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate?
The canonical SMILES for methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate is COC(=O)[C@@H](NC(=O)C1CCCC1)c1cc(F)ccc1F.
What is the InChIKey of methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate?
The InChIKey is VELWNNYKANLOCN-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H17F2NO3/c1-21-15(20)13(11-8-10(16)6-7-12(11)17)18-14(19)9-4-2-3-5-9/h6-9,13H,2-5H2,1H3,(H,18,19)/t13-/m0/s1.
What are the key properties of methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate?
methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate has a molecular weight of 297.30 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(cyclopentanecarbonylamino)-2-(2,5-difluorophenyl)acetate is sourced from PubChem (CID 95284034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).