C12H11F2NO2 — CID 55063341
methyl 2-(2,5-difluorophenyl)-2-(prop-2-ynylamino)acetate (PubChem CID 55063341) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is methyl 2-(2,5-difluorophenyl)-2-(prop-2-ynylamino)acetate.
| Compound Name | methyl 2-(2,5-difluorophenyl)-2-(prop-2-ynylamino)acetate |
|---|---|
| PubChem CID | 55063341 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | methyl 2-(2,5-difluorophenyl)-2-(prop-2-ynylamino)acetate |
| SMILES | C#CCNC(C(=O)OC)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H11F2NO2/c1-3-6-15-11(12(16)17-2)9-7-8(13)4-5-10(9)14/h1,4-5,7,11,15H,6H2,2H3 |
| InChIKey | MYYQVNYJCHFKHU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|