C15H16F3NO3 — CID 95140162
methyl (2R)-2-(cyclobutanecarbonylamino)-2-[2-(trifluoromethyl)phenyl]acetate (PubChem CID 95140162) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is methyl (2R)-2-(cyclobutanecarbonylamino)-2-[2-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl (2R)-2-(cyclobutanecarbonylamino)-2-[2-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 95140162 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl (2R)-2-(cyclobutanecarbonylamino)-2-[2-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)[C@H](NC(=O)C1CCC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO3/c1-22-14(21)12(19-13(20)9-5-4-6-9)10-7-2-3-8-11(10)15(16,17)18/h2-3,7-9,12H,4-6H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | ZCDQPAABKSFBCN-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |