C17H22F3N3O2 — CID 70760706
1-(2-amino-2-oxoethyl)-N-[1-[2-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide (PubChem CID 70760706) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-N-[1-[2-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-amino-2-oxoethyl)-N-[1-[2-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 70760706 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-N-[1-[2-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(CC(N)=O)CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H22F3N3O2/c1-11(13-4-2-3-5-14(13)17(18,19)20)22-16(25)12-6-8-23(9-7-12)10-15(21)24/h2-5,11-12H,6-10H2,1H3,(H2,21,24)(H,22,25) |
| InChIKey | ZUMQMSDFGAGOGS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |