C26H26FNO3 — CID 5161251
1-[(4-fluorophenyl)-(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 5161251) has the molecular formula C26H26FNO3 and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)-(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(4-fluorophenyl)-(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 5161251 |
| Molecular Formula | C26H26FNO3 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1-[(4-fluorophenyl)-(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(c2ccc(F)cc2)c2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C26H26FNO3/c27-23-11-9-20(10-12-23)25(28-15-13-21(14-16-28)26(29)30)22-7-4-8-24(17-22)31-18-19-5-2-1-3-6-19/h1-12,17,21,25H,13-16,18H2,(H,29,30) |
| InChIKey | UEJALZKXZYECKD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |