C27H26F3NO3 — CID 3676812
1-[(3-phenylmethoxyphenyl)-[2-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 3676812) has the molecular formula C27H26F3NO3 and a molecular weight of 469.50 g/mol. Its IUPAC name is 1-[(3-phenylmethoxyphenyl)-[2-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3-phenylmethoxyphenyl)-[2-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3676812 |
| Molecular Formula | C27H26F3NO3 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 1-[(3-phenylmethoxyphenyl)-[2-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(c2cccc(OCc3ccccc3)c2)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C27H26F3NO3/c28-27(29,30)24-12-5-4-11-23(24)25(31-15-13-20(14-16-31)26(32)33)21-9-6-10-22(17-21)34-18-19-7-2-1-3-8-19/h1-12,17,20,25H,13-16,18H2,(H,32,33) |
| InChIKey | UNNUFDMNVYTILP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |