C21H25NO3 — CID 3889238
1-[(3-methoxyphenyl)-(2-methylphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 3889238) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)-(2-methylphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3-methoxyphenyl)-(2-methylphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3889238 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[(3-methoxyphenyl)-(2-methylphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | COc1cccc(C(c2ccccc2C)N2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C21H25NO3/c1-15-6-3-4-9-19(15)20(17-7-5-8-18(14-17)25-2)22-12-10-16(11-13-22)21(23)24/h3-9,14,16,20H,10-13H2,1-2H3,(H,23,24) |
| InChIKey | IMNCARPQGAQLCU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |