C28H32N2O3 — CID 5038797
1-[[4-(dimethylamino)phenyl]-(4-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 5038797) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]-(4-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[4-(dimethylamino)phenyl]-(4-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 5038797 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]-(4-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CN(C)c1ccc(C(c2ccc(OCc3ccccc3)cc2)N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C28H32N2O3/c1-29(2)25-12-8-22(9-13-25)27(30-18-16-24(17-19-30)28(31)32)23-10-14-26(15-11-23)33-20-21-6-4-3-5-7-21/h3-15,24,27H,16-20H2,1-2H3,(H,31,32) |
| InChIKey | VKNDXMYIMISBFC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|