C23H21ClF2N2O2S — CID 92772065
1-(3-chloro-2-fluorophenyl)sulfonyl-4-[(S)-(4-fluorophenyl)-phenylmethyl]piperazine (PubChem CID 92772065) has the molecular formula C23H21ClF2N2O2S and a molecular weight of 462.95 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)sulfonyl-4-[(S)-(4-fluorophenyl)-phenylmethyl]piperazine.
| Compound Name | 1-(3-chloro-2-fluorophenyl)sulfonyl-4-[(S)-(4-fluorophenyl)-phenylmethyl]piperazine |
|---|---|
| PubChem CID | 92772065 |
| Molecular Formula | C23H21ClF2N2O2S |
| Molecular Weight | 462.95 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)sulfonyl-4-[(S)-(4-fluorophenyl)-phenylmethyl]piperazine |
| SMILES | O=S(=O)(c1cccc(Cl)c1F)N1CCN(C(c2ccccc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H21ClF2N2O2S/c24-20-7-4-8-21(22(20)26)31(29,30)28-15-13-27(14-16-28)23(17-5-2-1-3-6-17)18-9-11-19(25)12-10-18/h1-12,23H,13-16H2 |
| InChIKey | YHSCEBUQTSSVSP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |