C24H25ClN2O2S — CID 92770848
1-(3-chlorophenyl)sulfonyl-4-[(S)-(4-methylphenyl)-phenylmethyl]piperazine (PubChem CID 92770848) has the molecular formula C24H25ClN2O2S and a molecular weight of 441.00 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-4-[(S)-(4-methylphenyl)-phenylmethyl]piperazine.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-4-[(S)-(4-methylphenyl)-phenylmethyl]piperazine |
|---|---|
| PubChem CID | 92770848 |
| Molecular Formula | C24H25ClN2O2S |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-4-[(S)-(4-methylphenyl)-phenylmethyl]piperazine |
| SMILES | Cc1ccc(C(c2ccccc2)N2CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C24H25ClN2O2S/c1-19-10-12-21(13-11-19)24(20-6-3-2-4-7-20)26-14-16-27(17-15-26)30(28,29)23-9-5-8-22(25)18-23/h2-13,18,24H,14-17H2,1H3 |
| InChIKey | WQGJKSAKMZTDCL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |