C19H20ClNO3S — CID 110394188
[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone (PubChem CID 110394188) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is [1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone.
| Compound Name | [1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 110394188 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [1-(3-chlorophenyl)sulfonylpiperidin-4-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H20ClNO3S/c1-14-5-7-15(8-6-14)19(22)16-9-11-21(12-10-16)25(23,24)18-4-2-3-17(20)13-18/h2-8,13,16H,9-12H2,1H3 |
| InChIKey | YKNRASKZPZJCKZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |