C20H23NO3S — CID 34162008
[1-(benzenesulfonyl)piperidin-4-yl]-(2,4-dimethylphenyl)methanone (PubChem CID 34162008) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is [1-(benzenesulfonyl)piperidin-4-yl]-(2,4-dimethylphenyl)methanone.
| Compound Name | [1-(benzenesulfonyl)piperidin-4-yl]-(2,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 34162008 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [1-(benzenesulfonyl)piperidin-4-yl]-(2,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H23NO3S/c1-15-8-9-19(16(2)14-15)20(22)17-10-12-21(13-11-17)25(23,24)18-6-4-3-5-7-18/h3-9,14,17H,10-13H2,1-2H3 |
| InChIKey | LROFLNQGBNSIKR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |