C21H25NO4S — CID 26187564
(2,4,6-trimethylphenyl) 1-(benzenesulfonyl)piperidine-4-carboxylate (PubChem CID 26187564) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 1-(benzenesulfonyl)piperidine-4-carboxylate.
| Compound Name | (2,4,6-trimethylphenyl) 1-(benzenesulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 26187564 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2,4,6-trimethylphenyl) 1-(benzenesulfonyl)piperidine-4-carboxylate |
| SMILES | Cc1cc(C)c(OC(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H25NO4S/c1-15-13-16(2)20(17(3)14-15)26-21(23)18-9-11-22(12-10-18)27(24,25)19-7-5-4-6-8-19/h4-8,13-14,18H,9-12H2,1-3H3 |
| InChIKey | OFXYPEQUJLWTPS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|