C20H22N2O6S — CID 16549767
(2-carbamoyl-5-methoxyphenyl) 1-(benzenesulfonyl)piperidine-4-carboxylate (PubChem CID 16549767) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is (2-carbamoyl-5-methoxyphenyl) 1-(benzenesulfonyl)piperidine-4-carboxylate.
| Compound Name | (2-carbamoyl-5-methoxyphenyl) 1-(benzenesulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 16549767 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (2-carbamoyl-5-methoxyphenyl) 1-(benzenesulfonyl)piperidine-4-carboxylate |
| SMILES | COc1ccc(C(N)=O)c(OC(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H22N2O6S/c1-27-15-7-8-17(19(21)23)18(13-15)28-20(24)14-9-11-22(12-10-14)29(25,26)16-5-3-2-4-6-16/h2-8,13-14H,9-12H2,1H3,(H2,21,23) |
| InChIKey | ZPODKJVPPQBCLT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|