C24H29NO6S — CID 4875693
(2-acetyl-5-methoxyphenyl) 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 4875693) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is (2-acetyl-5-methoxyphenyl) 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (2-acetyl-5-methoxyphenyl) 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 4875693 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (2-acetyl-5-methoxyphenyl) 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COc1ccc(C(C)=O)c(OC(=O)C2CCN(S(=O)(=O)c3ccc(C(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C24H29NO6S/c1-16(2)18-5-8-21(9-6-18)32(28,29)25-13-11-19(12-14-25)24(27)31-23-15-20(30-4)7-10-22(23)17(3)26/h5-10,15-16,19H,11-14H2,1-4H3 |
| InChIKey | NXDJGFYYZWACLN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|