C20H21Cl2NO5S — CID 55335218
(2,4-dichlorophenyl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55335218) has the molecular formula C20H21Cl2NO5S and a molecular weight of 458.36 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (2,4-dichlorophenyl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55335218 |
| Molecular Formula | C20H21Cl2NO5S |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | (2,4-dichlorophenyl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(C(=O)Oc3ccc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H21Cl2NO5S/c1-2-27-16-4-6-17(7-5-16)29(25,26)23-11-9-14(10-12-23)20(24)28-19-8-3-15(21)13-18(19)22/h3-8,13-14H,2,9-12H2,1H3 |
| InChIKey | XTZOYOMECRIROR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|